ent-Ezetimibe structure
|
Common Name | ent-Ezetimibe | ||
|---|---|---|---|---|
| CAS Number | 1376614-99-1 | Molecular Weight | 409.42500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H21F2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ent-Ezetimibeent-Ezetimibe (ent-SCH 58235) is the RRS-enantiomer of Ezetimibe. Ezetimibe is a potent cholesterol absorption inhibitor. Ezetimibe is a Niemann-Pick C1-like1 (NPC1L1) inhibitor, and is a potent Nrf2 activator[1]. |
| Name | ezetimibe |
|---|---|
| Synonym | More Synonyms |
| Description | ent-Ezetimibe (ent-SCH 58235) is the RRS-enantiomer of Ezetimibe. Ezetimibe is a potent cholesterol absorption inhibitor. Ezetimibe is a Niemann-Pick C1-like1 (NPC1L1) inhibitor, and is a potent Nrf2 activator[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H21F2NO3 |
|---|---|
| Molecular Weight | 409.42500 |
| Exact Mass | 409.14900 |
| PSA | 60.77000 |
| LogP | 4.95330 |
| InChIKey | OLNTVTPDXPETLC-ZRBLBEILSA-N |
| SMILES | O=C1C(CCC(O)c2ccc(F)cc2)C(c2ccc(O)cc2)N1c1ccc(F)cc1 |
| Hazard Codes | Xi |
|---|
| ent-Ezetimibe |
| (3S,4R)-1-(4-Fluorophenyl)-3-[(3R)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)-2-azetidinone |
| Ezetimibe Impurity 1 |