Carbonic acid,4-nitrophenyl phenylmethyl ester structure
|
Common Name | Carbonic acid,4-nitrophenyl phenylmethyl ester | ||
|---|---|---|---|---|
| CAS Number | 13795-24-9 | Molecular Weight | 273.24100 | |
| Density | 1.326g/cm3 | Boiling Point | 438.3ºC at 760mmHg | |
| Molecular Formula | C14H11NO5 | Melting Point | 78-80ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 196.4ºC | |
| Name | Benzyl 4-Nitrophenyl Carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.326g/cm3 |
|---|---|
| Boiling Point | 438.3ºC at 760mmHg |
| Melting Point | 78-80ºC(lit.) |
| Molecular Formula | C14H11NO5 |
| Molecular Weight | 273.24100 |
| Flash Point | 196.4ºC |
| Exact Mass | 273.06400 |
| PSA | 81.35000 |
| LogP | 3.83360 |
| Vapour Pressure | 6.98E-08mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | QIXRWIVDBZJDGD-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)Oc1ccc([N+](=O)[O-])cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2920909090 |
|
~97%
Carbonic acid,4... CAS#:13795-24-9 |
| Literature: Tepe, Jetze J.; Madalengoitia, Jose S.; Slunt, Kelli M.; Werbovetz, Karl W.; Spoors, P. Grant; Macdonald, Timothy L. Journal of Medicinal Chemistry, 1996 , vol. 39, # 11 p. 2188 - 2196 |
|
~%
Carbonic acid,4... CAS#:13795-24-9 |
| Literature: Chemische Berichte, , vol. 99, p. 3914 - 3924 |
|
~82%
Carbonic acid,4... CAS#:13795-24-9 |
| Literature: Boykin, David W.; Rahmathullah, M. Syed; Tidwell, Richard R.; Hall, James E. Patent: US2002/19437 A1, 2002 ; |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| benzyl (4-nitrophenyl) carbonate |
| Carbonic Acid Benzyl 4-Nitrophenyl Ester |
| BENZYL 4-NITROPHENYL CARBONATE |
| MFCD00007323 |