distrontium,phosphonato phosphate structure
|
Common Name | distrontium,phosphonato phosphate | ||
|---|---|---|---|---|
| CAS Number | 13812-81-2 | Molecular Weight | 349.18300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | O7P2Sr2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | distrontium,phosphonato phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | O7P2Sr2 |
|---|---|
| Molecular Weight | 349.18300 |
| Exact Mass | 349.72300 |
| PSA | 155.23000 |
| LogP | 0.94120 |
| InChIKey | QGKBPWOLFJRLKE-UHFFFAOYSA-J |
| SMILES | O=P([O-])([O-])OP(=O)([O-])[O-].[Sr+2].[Sr+2] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
|
Photoluminescence of Sr(2)P(2)O(7):Bi(2+) as a red phosphor for additive light generation.
Optics Letters 15th ed., 35 , 2544, (2010) We report on photoluminescence of Sr(2)P(2)O(7):Bi(2+) as a potential red-emitting phosphor for multichromatic light sources. If excited with blue light, photoluminescence of this compound spans the s... |
|
|
Necmeddin; Y.; et. al.
J. Lumin. 12th ed., 13 , 1460, (2010)
|
| Distrontium diphosphate |
| Strontium pyrophosphate |
| distrontium phosphonato phosphate |
| Diphosphoric acid,strontium salt (1:2) |
| EINECS 237-461-4 |
| Distrontium diphosphate,Distrontium pyrophosphate,Strontium diphosphate |