Bis(2H4)ammonium sulfate structure
|
Common Name | Bis(2H4)ammonium sulfate | ||
|---|---|---|---|---|
| CAS Number | 13814-01-2 | Molecular Weight | 140.189 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | D8N2O4S | Melting Point | >280ºC (dec.)(lit.) | |
| MSDS | USA | Flash Point | N/A | |
Use of Bis(2H4)ammonium sulfateAmmonium sulphate-d8 is the deuterium labeled Ammonium sulphate,≥99.0%,AR[1]. Ammonium sulphate,≥99.0%,AR is an inorganic sulfate salt used for molecular biology[2]. |
| Name | ammonium-d8 sulfate |
|---|---|
| Synonym | More Synonyms |
| Description | Ammonium sulphate-d8 is the deuterium labeled Ammonium sulphate,≥99.0%,AR[1]. Ammonium sulphate,≥99.0%,AR is an inorganic sulfate salt used for molecular biology[2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
[2]. DIXON M. A nomogram for ammonium sulphate solutions. Biochem J. 1953 Jun;54(3):457-8. |
| Melting Point | >280ºC (dec.)(lit.) |
|---|---|
| Molecular Formula | D8N2O4S |
| Molecular Weight | 140.189 |
| Exact Mass | 140.070694 |
| PSA | 89.46000 |
| LogP | 1.07580 |
| InChIKey | BFNBIHQBYMNNAN-KTOHAENGSA-N |
| SMILES | O=S(=O)([O-])[O-].[NH4+].[NH4+] |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R22 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| Bis(H)ammonium sulfate |
| ammonium-d8sulphate |