Phosphonic acid,P,P'-[1,1'-biphenyl]-4,4'-diylbis- structure
|
Common Name | Phosphonic acid,P,P'-[1,1'-biphenyl]-4,4'-diylbis- | ||
|---|---|---|---|---|
| CAS Number | 13817-79-3 | Molecular Weight | 314.16800 | |
| Density | 1.64g/cm3 | Boiling Point | 634.5ºC at 760mmHg | |
| Molecular Formula | C12H12O6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 337.5ºC | |
| Name | [4-(4-phosphonophenyl)phenyl]phosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 634.5ºC at 760mmHg |
| Molecular Formula | C12H12O6P2 |
| Molecular Weight | 314.16800 |
| Flash Point | 337.5ºC |
| Exact Mass | 314.01100 |
| PSA | 134.68000 |
| LogP | 0.95960 |
| Vapour Pressure | 5.68E-17mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | QWSZMKCGMDROKE-UHFFFAOYSA-N |
| SMILES | O=P(O)(O)c1ccc(-c2ccc(P(=O)(O)O)cc2)cc1 |
| HS Code | 2931900090 |
|---|
|
~92%
Phosphonic acid... CAS#:13817-79-3 |
| Literature: Journal of the Chinese Chemical Society, , vol. 57, # 3 B p. 539 - 546 |
|
~%
Phosphonic acid... CAS#:13817-79-3 |
| Literature: Journal of the American Chemical Society, , vol. 77, p. 6223 |
|
~%
Phosphonic acid... CAS#:13817-79-3 |
| Literature: Journal of the American Chemical Society, , vol. 125, # 34 p. 10375 - 10383 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| biphenyl-4,4'-diyldiphosphonic acid |
| 4,4'-biphenyl-bis-phosphonic acid |