4,4'-Bis(diethoxyphosphono-methyl)-Biphenyl structure
|
Common Name | 4,4'-Bis(diethoxyphosphono-methyl)-Biphenyl | ||
|---|---|---|---|---|
| CAS Number | 17919-34-5 | Molecular Weight | 454.433 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 578.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H32O6P2 | Melting Point | 108-110°C | |
| MSDS | N/A | Flash Point | 316.4±50.4 °C | |
| Name | 1-(diethoxyphosphorylmethyl)-4-[4-(diethoxyphosphorylmethyl)phenyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 578.4±50.0 °C at 760 mmHg |
| Melting Point | 108-110°C |
| Molecular Formula | C22H32O6P2 |
| Molecular Weight | 454.433 |
| Flash Point | 316.4±50.4 °C |
| Exact Mass | 454.167419 |
| PSA | 90.68000 |
| LogP | 3.66 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | DRCOGQJUVZRNSQ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(Cc1ccc(-c2ccc(CP(=O)(OCC)OCC)cc2)cc1)OCC |
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | S22-S24/25 |
| WGK Germany | 3 |
| HS Code | 2916399090 |
|
~91%
4,4'-Bis(dietho... CAS#:17919-34-5 |
| Literature: Tetrahedron, , vol. 59, # 25 p. 4673 - 4685 |
|
~86%
4,4'-Bis(dietho... CAS#:17919-34-5 |
| Literature: Asian Journal of Chemistry, , vol. 22, # 5 p. 3929 - 3935 |
|
~89%
4,4'-Bis(dietho... CAS#:17919-34-5 |
| Literature: JP2005/200358 A, ; Page/Page column 41 ; |
|
~%
4,4'-Bis(dietho... CAS#:17919-34-5 |
| Literature: Tetrahedron, , vol. 59, # 25 p. 4673 - 4685 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4,4'-Bis(diethoxyphosphono-methyl)-Biphenyl |
| Tetraethyl [4,4'-biphenyldiylbis(methylene)]bis(phosphonate) |
| Tetraethyl [biphenyl-4,4'-diylbis(methylene)]bis(phosphonate) |
| Diethyl (4'-[(diethoxyphosphoryl)methyl][1,1'-biphenyl]-4-yl)methylphosphonate |
| 4,4-Bis(diethylphosphonomethyl)biphenyl |
| [4,4'-Biphenylylenebis(methylene)]bisphosphonic Acid Tetraethyl Ester |
| Phosphonic acid, P,P'-[[1,1'-biphenyl]-4,4'-diylbis(methylene)]bis-, tetraethyl ester |
| Phosphonic acid, [[1,1'-biphenyl]-4,4'-diylbis(methylene)]bis-, tetraethyl ester |
| tetraethyl (biphenyl-4,4'-diyldimethanediyl)bis(phosphonate) |
| 4,4'-Bis(diethylphosphonomethyl)biphenyl |
| Tetraethyl [4,4'-Biphenylylenebis(methylene)]bisphosphonate |
| MFCD01321144 |
| Bisdiethylphosphonomethylbiphenyl |