1,2,2-trifluoro-N,N-bis(trifluoromethyl)ethenamine structure
|
Common Name | 1,2,2-trifluoro-N,N-bis(trifluoromethyl)ethenamine | ||
|---|---|---|---|---|
| CAS Number | 13821-49-3 | Molecular Weight | 233.03500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4F9N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,2-trifluoro-N,N-bis(trifluoromethyl)ethenamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4F9N |
|---|---|
| Molecular Weight | 233.03500 |
| Exact Mass | 232.98900 |
| PSA | 3.24000 |
| LogP | 3.36310 |
| InChIKey | WZASSYDMYUZHRC-UHFFFAOYSA-N |
| SMILES | FC(F)=C(F)N(C(F)(F)F)C(F)(F)F |
|
~97%
1,2,2-trifluoro... CAS#:13821-49-3 |
| Literature: Gmelin Handbook: F: PerFHalOrg.9, 9, page 159 - 180 |
|
~95%
1,2,2-trifluoro... CAS#:13821-49-3 |
| Literature: Gmelin Handbook: F: PerFHalOrg.9, 9, page 159 - 180 |
|
~%
Detail
|
| Literature: Haszeldine,R.N.; Tipping,A.E. Journal of the Chemical Society [Section] C: Organic, 1968 , p. 398 - 405 |
|
~88%
1,2,2-trifluoro... CAS#:13821-49-3 |
| Literature: Abe, Takashi; Hayashi, Eiji; Shimizu, Tetsuo Chemistry Letters, 1989 , p. 905 - 908 |
| Perfluor-(N,N-dimethyl-vinylamin) |
| Perfluoro(N,N-dimethylvinylamine) |
| perfluorinated N,N-dimethylvinylamine |
| perfluoro(N,N-dimethyl trifluorovinylamine) |
| Ethenamine,1,2,2-trifluoro-N,N-bis(trifluoromethyl) |
| F-(N,N-dimethylvinylamine) |
| perfluorodimethylvinylamine |