1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine
1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine structure
|
Common Name | 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 815-28-1 | Molecular Weight | 271.03200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4F11N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C4F11N |
|---|---|
| Molecular Weight | 271.03200 |
| Exact Mass | 270.98600 |
| PSA | 3.24000 |
| LogP | 3.48310 |
| InChIKey | CGYSGEFXYQMNJM-UHFFFAOYSA-N |
| SMILES | FC(F)(F)N(C(F)(F)F)C(F)(F)C(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 3 | |
CAS#:371-71-1
CAS#:354-67-6
CAS#:3853-06-3
CAS#:106815-18-3
CAS#:598-56-1
CAS#:16654-64-1
CAS#:110-18-9
CAS#:10026-18-3
CAS#:616-39-7
CAS#:75-73-0
CAS#:353-85-5
CAS#:368-66-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Pentafluoraethyl-bis-trifluormethyl-amin |
| perfluoro(dimethylethylamine) |
| F-N,N-dimethylethylamine |
| Perfluoro(N,N-dimethylethylamine) |
| Ethanamine,1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl) |
| pentafluoroethyl-bis-trifluoromethyl-amine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 815-28-1? |
| A: Chinese name of 815-28-1 is 815-28-1. |
| Q: What is the CAS number of 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine? |
| A: CAS number of 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine is 815-28-1. |
| Q: What is the LogP of 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine? |
| A: LogP of 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine is 3.48310. |
| Q: What is the English name of 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine? |
| A: The English name of 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine is 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine. |
| Q: What English synonyms does 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine have? |
| A: English synonyms of 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine: Pentafluoraethyl-bis-trifluormethyl-amin, perfluoro(dimethylethylamine), F-N,N-dimethylethylamine, Perfluoro(N,N-dimethylethylamine), Ethanamine,1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl), pentafluoroethyl-bis-trifluoromethyl-amine. |
| Q: What is the SMILES notation of 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine? |
| A: SMILES notation of 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine is FC(F)(F)N(C(F)(F)F)C(F)(F)C(F)(F)F. |
| Q: What is the InChIKey of 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine? |
| A: InChIKey of 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine is CGYSGEFXYQMNJM-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine? |
| A: Molecular weight of 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine is 271.03200. |
| Q: What are the upstream materials of 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine? |
| A: Related upstream materials(CAS) of 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine: 371-71-1;354-67-6;3853-06-3;106815-18-3;598-56-1;16654-64-1;110-18-9;10026-18-3;616-39-7. |
| Q: What is the polar surface area (PSA) of 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine? |
| A: Polar surface area (PSA) of 1,1,2,2,2-pentafluoro-N,N-bis(trifluoromethyl)ethanamine is 3.24000. |