4,4'-Bis(chloromethyl)-2,2'-bipyridine structure
|
Common Name | 4,4'-Bis(chloromethyl)-2,2'-bipyridine | ||
|---|---|---|---|---|
| CAS Number | 138219-98-4 | Molecular Weight | 253.127 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 406.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C12H10Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.8±12.9 °C | |
| Name | 4,4'-Bis(chloromethyl)-2,2'-bipyridyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 406.0±40.0 °C at 760 mmHg |
| Molecular Formula | C12H10Cl2N2 |
| Molecular Weight | 253.127 |
| Flash Point | 231.8±12.9 °C |
| Exact Mass | 252.022110 |
| PSA | 25.78000 |
| LogP | 1.82 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | VZKSOWFFOHQARA-UHFFFAOYSA-N |
| SMILES | ClCc1ccnc(-c2cc(CCl)ccn2)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~94%
4,4'-Bis(chloro... CAS#:138219-98-4 |
| Literature: Journal of Organic Chemistry, , vol. 62, # 26 p. 9314 - 9317 |
|
~%
4,4'-Bis(chloro... CAS#:138219-98-4 |
| Literature: Tetrahedron Letters, , vol. 40, # 18 p. 3647 - 3650 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,2'-Bipyridine, 4,4'-bis(chloromethyl)- |
| 4,4'-Bis(chloromethyl)-2,2'-bipyridine |
| 4,4'-Bis(chloroMethyl)-2,2'-bipyridyl |
| 4-(chloromethyl)-2-[4-(chloromethyl)pyridin-2-yl]pyridine |