tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate
tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate structure
|
Common Name | tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 138227-68-6 | Molecular Weight | 336.38300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H24N2O5 |
|---|---|
| Molecular Weight | 336.38300 |
| Exact Mass | 336.16900 |
| PSA | 84.59000 |
| LogP | 4.14260 |
| InChIKey | YNMNCFUFQJZIFY-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])ccc1OC1CCN(C(=O)OC(C)(C)C)CC1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933399090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
CAS#:99-53-6
CAS#:109384-19-2
CAS#:455-88-9This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate? |
| A: SMILES notation of tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate is Cc1cc([N+](=O)[O-])ccc1OC1CCN(C(=O)OC(C)(C)C)CC1. |
| Q: What is the polar surface area (PSA) of tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate? |
| A: Polar surface area (PSA) of tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate is 84.59000. |
| Q: What is the molecular formula of tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate? |
| A: Molecular formula of tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate is C17H24N2O5. |
| Q: What is the English name of tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate? |
| A: The English name of tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate is tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate. |
| Q: What is the InChIKey of tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate? |
| A: InChIKey of tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate is YNMNCFUFQJZIFY-UHFFFAOYSA-N. |
| Q: What is the CAS number of tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate? |
| A: CAS number of tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate is 138227-68-6. |
| Q: What is the LogP of tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate? |
| A: LogP of tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate is 4.14260. |
| Q: What are the upstream materials of tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate? |
| A: Related upstream materials(CAS) of tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate: 99-53-6;109384-19-2;455-88-9. |
| Q: What is the molecular weight of tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate? |
| A: Molecular weight of tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate is 336.38300. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |