N-BOC-4-Hydroxypiperidine structure
|
Common Name | N-BOC-4-Hydroxypiperidine | ||
|---|---|---|---|---|
| CAS Number | 109384-19-2 | Molecular Weight | 201.26 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 292.3±33.0 °C at 760 mmHg | |
| Molecular Formula | C10H19NO3 | Melting Point | 61-65 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 130.6±25.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of N-BOC-4-Hydroxypiperidinetert-Butyl 4-hydroxypiperidine-1-carboxylate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | N-BOC-4-Hydroxypiperidine |
|---|---|
| Synonym | More Synonyms |
| Description | tert-Butyl 4-hydroxypiperidine-1-carboxylate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 292.3±33.0 °C at 760 mmHg |
| Melting Point | 61-65 °C(lit.) |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.26 |
| Flash Point | 130.6±25.4 °C |
| Exact Mass | 201.136490 |
| PSA | 49.77000 |
| LogP | 0.61 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | PWQLFIKTGRINFF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)CC1 |
| Storage condition | Store at -15°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Tetrahedron Lett. 48 , 791, (2007)
|
| 1-Boc-4-piperidinol |
| tert-butyl 4-hydroxytetrahydropyridine-1(2H)-carboxylate |
| 1-Boc-4-Hydroxylpiperidine |
| N-Boc-4-hydroxy piperidine |
| 1-Boc-4-hydroxypiperidine |
| 2-Methyl-2-propanyl 4-hydroxy-1-piperidinecarboxylate |
| 1-Piperidinecarboxylic acid, 4-hydroxy-, 1,1-dimethylethyl ester |
| tert-butyl 4-Hydroxypiperidine-1-carboxylate |
| N-Boc-4-piperidinol |
| MFCD01075174 |
| tert-Butyl-4-hydroxypiperidin-1-carboxylat |
| 1-(tert-Butoxycarbonyl)-4-hydroxypiperidine |
| 1-Boc -4-hydroxypeiperidine |
| tert-Butyl 4-hydroxy-1-piperidinecarboxylate |