2,3-Bis(3-indolylmethyl)indole structure
|
Common Name | 2,3-Bis(3-indolylmethyl)indole | ||
|---|---|---|---|---|
| CAS Number | 138250-72-3 | Molecular Weight | 375.47 | |
| Density | 1.314g/cm3 | Boiling Point | 682.1ºC at 760mmHg | |
| Molecular Formula | C26H21N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.6ºC | |
Use of 2,3-Bis(3-indolylmethyl)indole2,3-Bis(3-indolylmethyl)indole significantly suppresses RANKL-induced osteoclast formation, actin ring formation, and bone resorption in a concentration-dependent manner. |
| Name | 2,3-bis(1H-indol-3-ylmethyl)-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Description | 2,3-Bis(3-indolylmethyl)indole significantly suppresses RANKL-induced osteoclast formation, actin ring formation, and bone resorption in a concentration-dependent manner. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 682.1ºC at 760mmHg |
| Molecular Formula | C26H21N3 |
| Molecular Weight | 375.47 |
| Flash Point | 306.6ºC |
| Exact Mass | 375.17400 |
| PSA | 47.37000 |
| LogP | 6.31210 |
| Vapour Pressure | 1.09E-17mmHg at 25°C |
| Index of Refraction | 1.796 |
| InChIKey | MJHVZTDHBWQIMN-UHFFFAOYSA-N |
| SMILES | c1ccc2c(Cc3[nH]c4ccccc4c3Cc3c[nH]c4ccccc34)c[nH]c2c1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1H-Indole,2,3-bis(1H-indol-3-ylmethyl) |
| 2-(indol-3-ylmethyl)-3,3'-diindolylmethane |
| Bisimi |
| 2,3-diskatylindole |
| 3,3'-indole-2,3-diyldimethyl-bis-indole |
| 2-(indol-3-ylmethyl)-3,3'-methylenediindole |
| 2,3-Bis(3-indolylmethyl)indole |
| 3,3'-(1H-indole-2,3-diyl)bis(methylene)bis(1H-indole) |