Azidamfenicol structure
|
Common Name | Azidamfenicol | ||
|---|---|---|---|---|
| CAS Number | 13838-08-9 | Molecular Weight | 295.25100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13N5O5 | Melting Point | 107° | |
| MSDS | N/A | Flash Point | N/A | |
Use of AzidamfenicolAzidamfenicol is a broad-spectrum chloramphenicol-like antibiotic. Azidamfenicol inhibits ribosomal peptidyltransferase (Ki=22 µM)[1]. |
| Name | 2-azido-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Description | Azidamfenicol is a broad-spectrum chloramphenicol-like antibiotic. Azidamfenicol inhibits ribosomal peptidyltransferase (Ki=22 µM)[1]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 107° |
|---|---|
| Molecular Formula | C11H13N5O5 |
| Molecular Weight | 295.25100 |
| Exact Mass | 295.09200 |
| PSA | 165.13000 |
| LogP | 0.78246 |
| InChIKey | SGRUZFCHLOFYHZ-MWLCHTKSSA-N |
| SMILES | [N-]=[N+]=NCC(=O)NC(CO)C(O)c1ccc([N+](=O)[O-])cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2929909090 |
|
~%
Azidamfenicol CAS#:13838-08-9 |
| Literature: Farbenfabr. Bayer Patent: DE1008747 , 1955 ; |
|
~%
Azidamfenicol CAS#:13838-08-9 |
| Literature: Farbenfabr. Bayer Patent: DE1008747 , 1955 ; |
| HS Code | 2929909090 |
|---|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Berlicetin |
| Leukomycin N |
| Azidamphenicolum |
| Azidanfenicol |
| Azidamfenicolum |
| Azidoamphenicol |
| azidamfenicol |