6-Bromo-2-(chloromethyl)-8-(4-methylpiperazin-1-YL)imidazo[1,2-A]pyrazine
Modify Date: 2026-07-15 23:05:19
![6-Bromo-2-(chloromethyl)-8-(4-methylpiperazin-1-YL)imidazo[1,2-A]pyrazine Structure](https://www.chemsrc.com/extcaspic/065/1384265-46-6.png)
6-Bromo-2-(chloromethyl)-8-(4-methylpiperazin-1-YL)imidazo[1,2-A]pyrazine structure
|
Common Name | 6-Bromo-2-(chloromethyl)-8-(4-methylpiperazin-1-YL)imidazo[1,2-A]pyrazine | ||
|---|---|---|---|---|
| CAS Number | 1384265-46-6 | Molecular Weight | 344.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15BrClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Bromo-2-(chloromethyl)-8-(4-methylpiperazin-1-YL)imidazo[1,2-A]pyrazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15BrClN5 |
|---|---|
| Molecular Weight | 344.64 |
| InChIKey | HUIUBJBNARVIAV-UHFFFAOYSA-N |
| SMILES | CN1CCN(c2nc(Br)cn3cc(CCl)nc23)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 6-Bromo-2-(chloromethyl)-8-(4-methylpiperazin-1-YL)imidazo[1,2-A]pyrazine? |
| A: InChIKey of 6-Bromo-2-(chloromethyl)-8-(4-methylpiperazin-1-YL)imidazo[1,2-A]pyrazine is HUIUBJBNARVIAV-UHFFFAOYSA-N. |
| Q: What is the English name of 6-Bromo-2-(chloromethyl)-8-(4-methylpiperazin-1-YL)imidazo[1,2-A]pyrazine? |
| A: The English name of 6-Bromo-2-(chloromethyl)-8-(4-methylpiperazin-1-YL)imidazo[1,2-A]pyrazine is 6-Bromo-2-(chloromethyl)-8-(4-methylpiperazin-1-YL)imidazo[1,2-A]pyrazine. |
| Q: What is the CAS number of 6-Bromo-2-(chloromethyl)-8-(4-methylpiperazin-1-YL)imidazo[1,2-A]pyrazine? |
| A: CAS number of 6-Bromo-2-(chloromethyl)-8-(4-methylpiperazin-1-YL)imidazo[1,2-A]pyrazine is 1384265-46-6. |
| Q: What is the SMILES notation of 6-Bromo-2-(chloromethyl)-8-(4-methylpiperazin-1-YL)imidazo[1,2-A]pyrazine? |
| A: SMILES notation of 6-Bromo-2-(chloromethyl)-8-(4-methylpiperazin-1-YL)imidazo[1,2-A]pyrazine is CN1CCN(c2nc(Br)cn3cc(CCl)nc23)CC1. |
| Q: What is the molecular weight of 6-Bromo-2-(chloromethyl)-8-(4-methylpiperazin-1-YL)imidazo[1,2-A]pyrazine? |
| A: Molecular weight of 6-Bromo-2-(chloromethyl)-8-(4-methylpiperazin-1-YL)imidazo[1,2-A]pyrazine is 344.64. |
| Q: What is the Chinese name of 1384265-46-6? |
| A: Chinese name of 1384265-46-6 is 1384265-46-6. |
| Q: What is the molecular formula of 6-Bromo-2-(chloromethyl)-8-(4-methylpiperazin-1-YL)imidazo[1,2-A]pyrazine? |
| A: Molecular formula of 6-Bromo-2-(chloromethyl)-8-(4-methylpiperazin-1-YL)imidazo[1,2-A]pyrazine is C12H15BrClN5. |