NOR3 structure
|
Common Name | NOR3 | ||
|---|---|---|---|---|
| CAS Number | 138472-01-2 | Molecular Weight | 215.206 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 428.2±47.0 °C at 760 mmHg | |
| Molecular Formula | C8H13N3O4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 212.7±29.3 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
Use of NOR3FK409 is a cell permeable NO donor which produces vasorelaxation. |
| Name | (±)-(E)-4-Ethyl-2-[(E)-hydroxyimino]-5-nitro-3-hexenamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 428.2±47.0 °C at 760 mmHg |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.206 |
| Flash Point | 212.7±29.3 °C |
| Exact Mass | 215.090607 |
| PSA | 110.50000 |
| LogP | 1.18 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | MZAGXDHQGXUDDX-UHFFFAOYSA-N |
| SMILES | CCC(=CC(=NO)C(N)=O)C(C)[N+](=O)[O-] |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | P301 + P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Risk Phrases | R25 |
| Safety Phrases | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
|
Spontaneous nitric oxide release accounts for the potent pharmacological actions of FK409.
Eur. J. Pharmacol. 257 , 123, (1994) (+-)-(E)-Ethyl-2-[(E)-hydroxyimino]-5-nitro-3-hexeneamide (FK409), which was isolated from microbial products, has been reported to show a vasorelaxant effect through a mechanism similar to that of th... |
| (E,2E)-4-ethyl-2-hydroxyimino-5-nitrohex-3-enamide |
| (2E,3E)-4-Ethyl-2-(hydroxyimino)-5-nitro-3-hexenamide |
| 3-Hexenamide, 4-ethyl-2-(hydroxyimino)-5-nitro-, (2E,3E)- |
| (2E,3E)-4-ethyl-2-(hydroxyimino)-5-nitrohex-3-enamide |