2-[[3,5-bis(trifluoromethyl)phenyl]hydrazinylidene]propanedinitrile
Modify Date: 2025-08-24 18:33:36
![2-[[3,5-bis(trifluoromethyl)phenyl]hydrazinylidene]propanedinitrile Structure](https://image.chemsrc.com/caspic/243/138555-70-1.png)
2-[[3,5-bis(trifluoromethyl)phenyl]hydrazinylidene]propanedinitrile structure
|
Common Name | 2-[[3,5-bis(trifluoromethyl)phenyl]hydrazinylidene]propanedinitrile | ||
|---|---|---|---|---|
| CAS Number | 138555-70-1 | Molecular Weight | 306.16700 | |
| Density | 1.44g/cm3 | Boiling Point | 269.1ºC at 760 mmHg | |
| Molecular Formula | C11H4F6N4 | Melting Point | 138-140ºC | |
| MSDS | N/A | Flash Point | 116.5ºC | |
| Name | 2-[[3,5-bis(trifluoromethyl)phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 269.1ºC at 760 mmHg |
| Melting Point | 138-140ºC |
| Molecular Formula | C11H4F6N4 |
| Molecular Weight | 306.16700 |
| Flash Point | 116.5ºC |
| Exact Mass | 306.03400 |
| PSA | 71.97000 |
| LogP | 3.61226 |
| Vapour Pressure | 0.0074mmHg at 25°C |
| Index of Refraction | 1.485 |
| InChIKey | RSQQTABIHVIOPI-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)=NNc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2928000090 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-{2-[3,5-Bis(trifluoromethyl)phenyl]hydrazono}malononitrile |
| [(3,5-di-{trifluoromethyl}phenyl)-hydrazono]propanedinitrile |
| 2-{2-[3,5-di(trifluoromethyl)phenyl]hydrazono}malononitrile |