2-Methyl-10H-benzo[b]thieno[2,3-e][1,4]diazepin-4-amine hydrochloride
![2-Methyl-10H-benzo[b]thieno[2,3-e][1,4]diazepin-4-amine hydrochloride Structure](https://image.chemsrc.com/caspic/185/138564-60-0.png)
2-Methyl-10H-benzo[b]thieno[2,3-e][1,4]diazepin-4-amine hydrochloride structure
|
Common Name | 2-Methyl-10H-benzo[b]thieno[2,3-e][1,4]diazepin-4-amine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 138564-60-0 | Molecular Weight | 265.762 | |
| Density | N/A | Boiling Point | 459.8ºC at 760 mmHg | |
| Molecular Formula | C12H12ClN3S | Melting Point | 283-285ºC | |
| MSDS | N/A | Flash Point | 231.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 459.8ºC at 760 mmHg |
|---|---|
| Melting Point | 283-285ºC |
| Molecular Formula | C12H12ClN3S |
| Molecular Weight | 265.762 |
| Flash Point | 231.9ºC |
| Exact Mass | 265.044037 |
| PSA | 78.65000 |
| LogP | 4.22640 |
| Vapour Pressure | 0.000739mmHg at 25°C |
| InChIKey | FDWMAKNNNPSUTL-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(s1)Nc1ccccc1N=C2N.Cl |
| Storage condition | -20°C Freezer |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2934999090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 10H-thieno2,3-b1,5benzodiazepin-4-amine, 2-methyl-, hydrochloride (1:1) |
| 2-Methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-amine hydrochloride (1:1) |
| 2-Methyl-10H-thieno[2,3-b][1,5]benzodiazepin-4-amine hydrochloride |
| 4-Amino-2-methyl-10H-thiene[2,3-b][1,5]benzodiazepine hydrochloride |
| 2-methyl-10H-thieno2,3-b1,5benzodiazepin-4-amine hydrochloride |
| Olanzipine intermediate:2-Methyl-4-amnio-10H-thieno[2,3-b][1,5]benzodiazepine hydrochloride |
| 2-Methyl-10H-benzo[b]thieno[2,3-e][1,4]diazepin-4-amine hydrochloride |
| 10H-Thieno[2,3-b][1,5]benzodiazepin-4-amine, 2-methyl-, hydrochloride (1:1) |
| MFCD03085920 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the melting point of 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride? |
| A: Melting point of 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride is 283-285ºC. |
| Q: What is the LogP of 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride? |
| A: LogP of 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride is 4.22640. |
| Q: What is the molecular weight of 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride? |
| A: Molecular weight of 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride is 265.762. |
| Q: What is the safety information for 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride? |
| A: Safety information for 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride: S26-S36/37/39. |
| Q: What is the boiling point of 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride? |
| A: Boiling point of 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride is 459.8ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride? |
| A: Polar surface area (PSA) of 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride is 78.65000. |
| Q: What are the storage conditions for 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride? |
| A: Storage conditions for 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride: -20°C Freezer. |
| Q: What is the English name of 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride? |
| A: The English name of 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride is 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride. |
| Q: What is the CAS number of 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride? |
| A: CAS number of 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride is 138564-60-0. |
| Q: What is the molecular formula of 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride? |
| A: Molecular formula of 4-Amino-2-methyl-10H-thieno[2,3-b][1,5]-benzodiazapine, Hydrochloride is C12H12ClN3S. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |