1-(2-Chlorophenyl)-4-oxocyclohexanecarboxylic acid structure
|
Common Name | 1-(2-Chlorophenyl)-4-oxocyclohexanecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1385694-61-0 | Molecular Weight | 252.69400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-Chlorophenyl)-4-oxocyclohexanecarboxylic acid |
|---|
| Molecular Formula | C13H13ClO3 |
|---|---|
| Molecular Weight | 252.69400 |
| Exact Mass | 252.05500 |
| PSA | 54.37000 |
| LogP | 2.80550 |
| InChIKey | ZBDTUKWTMANXAU-UHFFFAOYSA-N |
| SMILES | O=C1CCC(C(=O)O)(c2ccccc2Cl)CC1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |