1-(4-Chlorophenyl)-4-oxocyclohexanecarboxylic acid structure
|
Common Name | 1-(4-Chlorophenyl)-4-oxocyclohexanecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 854446-73-4 | Molecular Weight | 252.693 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 431.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.0±28.7 °C | |
| Name | 1-(4-Chlorophenyl)-4-oxocyclohexanecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 431.9±45.0 °C at 760 mmHg |
| Molecular Formula | C13H13ClO3 |
| Molecular Weight | 252.693 |
| Flash Point | 215.0±28.7 °C |
| Exact Mass | 252.055328 |
| PSA | 54.37000 |
| LogP | 2.14 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | FKYDNMYCXJKDIR-UHFFFAOYSA-N |
| SMILES | O=C1CCC(C(=O)O)(c2ccc(Cl)cc2)CC1 |
| HS Code | 2918300090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1-(4-Chlor-phenyl)-4-methyl-pent-1-en-3-on |
| 1-(4-Chlorophenyl)-4-oxocyclohexanecarboxylicAcid |
| 1-(4-Chlor-phenyl)-4-oxo-cyclohexancarbonsaeure |
| 1-(4-Chlorophenyl)-4-oxocyclohexanecarboxylic acid |
| 1-(4-chlorophenyl)-4-methyl-1-penten-3-one |
| 1-(4-Chlorophenyl)-4-methylpent-1-en-3-one |