(R)-3-Carboxy-4-hydroxyphenylglycine structure
|
Common Name | (R)-3-Carboxy-4-hydroxyphenylglycine | ||
|---|---|---|---|---|
| CAS Number | 13861-03-5 | Molecular Weight | 211.17 | |
| Density | 1.596g/cm3 | Boiling Point | 466.4ºC at 760 mmHg | |
| Molecular Formula | C9H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.8ºC | |
Use of (R)-3-Carboxy-4-hydroxyphenylglycine(R)-3C4HPG is an NMDA receptor antagonist[1]. |
| Name | (r)-3-carboxy-4-hydroxyphenylglycine |
|---|---|
| Synonym | More Synonyms |
| Description | (R)-3C4HPG is an NMDA receptor antagonist[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.596g/cm3 |
|---|---|
| Boiling Point | 466.4ºC at 760 mmHg |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17 |
| Flash Point | 235.8ºC |
| Exact Mass | 211.04800 |
| PSA | 120.85000 |
| LogP | 0.87510 |
| Vapour Pressure | 1.69E-09mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | CHZBCZTXSTWCIG-SSDOTTSWSA-N |
| SMILES | NC(C(=O)O)c1ccc(O)c(C(=O)O)c1 |
| Dihydrosphingosine |