methyl 2-acetamido-5-bromobenzoate structure
|
Common Name | methyl 2-acetamido-5-bromobenzoate | ||
|---|---|---|---|---|
| CAS Number | 138825-96-4 | Molecular Weight | 272.09500 | |
| Density | 1.54 g/cm3 | Boiling Point | 415.5ºC at 760 mmHg | |
| Molecular Formula | C10H10BrNO3 | Melting Point | 131ºC | |
| MSDS | Chinese USA | Flash Point | 205.1ºC | |
| Name | methyl 2-acetamido-5-bromobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54 g/cm3 |
|---|---|
| Boiling Point | 415.5ºC at 760 mmHg |
| Melting Point | 131ºC |
| Molecular Formula | C10H10BrNO3 |
| Molecular Weight | 272.09500 |
| Flash Point | 205.1ºC |
| Exact Mass | 270.98400 |
| PSA | 55.40000 |
| LogP | 2.26710 |
| Vapour Pressure | 4.1E-07mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | CPARHIBNDSEJGR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Br)ccc1NC(C)=O |
|
~90%
methyl 2-acetam... CAS#:138825-96-4 |
| Literature: Osadchii; Shul'ts; Polukhina; Shakirov; Tolstikov Russian Chemical Bulletin, 2006 , vol. 55, # 6 p. 1077 - 1084 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00144758 |
| Methyl 2-acetamido-5-bromobenzoate |
| 2-acetamido-5-bromobenzoic acid methyl ester |
| N-(2-Carbomethoxy-4-bromo-phenyl)acetamide |
| methyl 5-bromo-N-acetylanthranilate |
| 2-(Acetylamino)-5-Bromo-Benzoic Acid Methyl Ester |
| methyl 2-(acetylamino)-5-bromobenzoate |