t-butyl(dichloromethyl)dimethylsilane structure
|
Common Name | t-butyl(dichloromethyl)dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 138983-08-1 | Molecular Weight | 199.193 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 193.9±20.0 °C at 760 mmHg | |
| Molecular Formula | C7H16Cl2Si | Melting Point | 42-45ºC(lit.) | |
| MSDS | N/A | Flash Point | 69.3±16.6 °C | |
| Name | tert-butyl-(dichloromethyl)-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 193.9±20.0 °C at 760 mmHg |
| Melting Point | 42-45ºC(lit.) |
| Molecular Formula | C7H16Cl2Si |
| Molecular Weight | 199.193 |
| Flash Point | 69.3±16.6 °C |
| Exact Mass | 198.039825 |
| LogP | 3.78 |
| Appearance of Characters | solid |
| Vapour Pressure | 0.6±0.4 mmHg at 25°C |
| Index of Refraction | 1.434 |
| InChIKey | IIGQYABNVUNASW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)C(Cl)Cl |
| Storage condition | ?20°C |
|
~85%
t-butyl(dichlor... CAS#:138983-08-1 |
| Literature: Shinokubo, Hiroshi; Miura, Katsukiyo; Oshima, Koichiro; Utimoto, Kiitiro Tetrahedron, 1996 , vol. 52, # 2 p. 503 - 514 |
| tert-butyldimethyl(dichloromethyl)silane |
| Silane, (dichloromethyl)(1,1-dimethylethyl)dimethyl- |
| t-butyl(dichloromethyl)dimethylsilane |
| tert-butyldichloromethyldimethylsilane |
| (Dichloromethyl)(dimethyl)(2-methyl-2-propanyl)silane |
| Dichlor<(1,1-dimethylethyl)dimethylsilyl>methan |