Ethanone,1-[3-(benzoyloxy)phenyl]-2-bromo- structure
|
Common Name | Ethanone,1-[3-(benzoyloxy)phenyl]-2-bromo- | ||
|---|---|---|---|---|
| CAS Number | 139-27-5 | Molecular Weight | 319.15000 | |
| Density | 1.466g/cm3 | Boiling Point | 432.6ºC at 760mmHg | |
| Molecular Formula | C15H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.4ºC | |
| Name | 2-Bromo-3'-hydroxyacetophenone benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.466g/cm3 |
|---|---|
| Boiling Point | 432.6ºC at 760mmHg |
| Molecular Formula | C15H11BrO3 |
| Molecular Weight | 319.15000 |
| Flash Point | 215.4ºC |
| Exact Mass | 317.98900 |
| PSA | 43.37000 |
| LogP | 3.48340 |
| Vapour Pressure | 1.1E-07mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | NBQCBERBYQMIFD-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1cccc(OC(=O)c2ccccc2)c1 |
| HS Code | 2916310090 |
|---|
| HS Code | 2916310090 |
|---|---|
| Summary | 2916310090 other benzoic acid and its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| APLPHA-BROMO-M-BENZOYLOXYACETOPHENONE |
| 1-bromo-4'-benzoyloxy acid |