Phenyltrimethylammonium tribromide structure
|
Common Name | Phenyltrimethylammonium tribromide | ||
|---|---|---|---|---|
| CAS Number | 4207-56-1 | Molecular Weight | 375.92600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14Br3N | Melting Point | 110-115 °C (dec.)(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Phenyltrimethylammonium Tribromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 110-115 °C (dec.)(lit.) |
|---|---|
| Molecular Formula | C9H14Br3N |
| Molecular Weight | 375.92600 |
| Exact Mass | 372.86800 |
| LogP | 0.57850 |
| InChIKey | PRXNKYBFWAWBNZ-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)C1=CC=CC=C1.Br[Br-]Br |
| Storage condition | Refrigerator |
| Hazard Codes | C:Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45-S24/25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 6.1(b) |
| HS Code | 2923900090 |
|
~%
Phenyltrimethyl... CAS#:4207-56-1 |
| Literature: Chemische Berichte, , vol. 31, p. 1349 |
|
~%
Phenyltrimethyl... CAS#:4207-56-1 |
| Literature: Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, , vol. 48, # 4 p. 611 - 616 |
|
~%
Phenyltrimethyl... CAS#:4207-56-1 |
| Literature: Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, , vol. 50, # 8 p. 1123 - 1127 |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD00011789 |
| EINECS 224-127-8 |
| Mono(N,N,N-trimethylbenzenaminium) tribromide |
| TriMethylphenylaMMoniuM TribroMide |
| Phenyltrimethylammonium tribromide |