N-(3,4-Dimethoxyphenethyl)-2-(3,4-dimethoxyphenyl)acetamide structure
|
Common Name | N-(3,4-Dimethoxyphenethyl)-2-(3,4-dimethoxyphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 139-76-4 | Molecular Weight | 359.41600 | |
| Density | 1.13g/cm3 | Boiling Point | 559.3ºC at 760 mmHg | |
| Molecular Formula | C20H25NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292ºC | |
| Name | 2-(3,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 559.3ºC at 760 mmHg |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.41600 |
| Flash Point | 292ºC |
| Exact Mass | 359.17300 |
| PSA | 69.51000 |
| LogP | 3.46270 |
| Vapour Pressure | 1.54E-12mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | KDIKNBJFJOYFNY-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCNC(=O)Cc2ccc(OC)c(OC)c2)cc1OC |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(3,4-dimethoxyphenethyl)-2-(3,4-dimethoxyphenyl)acetamide |