[Lys8, Lys9]-Neurotensin (8-13) structure
|
Common Name | [Lys8, Lys9]-Neurotensin (8-13) | ||
|---|---|---|---|---|
| CAS Number | 139026-64-5 | Molecular Weight | 760.96400 | |
| Density | 1.203 g/cm3 | Boiling Point | 1109.7ºC at 760 mmHg | |
| Molecular Formula | C38H64N8O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 624.9ºC | |
Use of [Lys8, Lys9]-Neurotensin (8-13)[Lys8, Lys9]-Neurotensin (8-13) (JMV438), a Neurotensin analog, exerts its analgesic effects through activation of the G protein-coupled receptors NTS1 and NTS2, with Ki values of 0.33 nM and 0.95 nM for hNTS1 and hNTS2 receptors, respectively[1]. |
| Name | [Lys8,9]-Neurotensin (8-13),KKPYIL |
|---|---|
| Synonym | More Synonyms |
| Description | [Lys8, Lys9]-Neurotensin (8-13) (JMV438), a Neurotensin analog, exerts its analgesic effects through activation of the G protein-coupled receptors NTS1 and NTS2, with Ki values of 0.33 nM and 0.95 nM for hNTS1 and hNTS2 receptors, respectively[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.203 g/cm3 |
|---|---|
| Boiling Point | 1109.7ºC at 760 mmHg |
| Molecular Formula | C38H64N8O8 |
| Molecular Weight | 760.96400 |
| Flash Point | 624.9ºC |
| Exact Mass | 760.48500 |
| PSA | 272.30000 |
| LogP | 4.22940 |
| InChIKey | JDVIBJLNEIKOTF-VDXNIVNJSA-N |
| SMILES | CCC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C1CCCN1C(=O)C(CCCCN)NC(=O)C(N)CCCCN)C(=O)NC(CC(C)C)C(=O)O |
| Storage condition | -20°C |
| [lys8,9]-neurotensin (8-13) |
| lys-lys-pro-tyr-ile-leu |
| h-lys-lys-pro-tyr-ile-leu-oh |
| kkpyil |
| (lys8,lys9)-neurotensin (8-13) |