1-Fluoro-4-isocyanato-2-(trifluoromethyl)benzene structure
|
Common Name | 1-Fluoro-4-isocyanato-2-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 139057-86-6 | Molecular Weight | 205.109 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 181.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H3F4NO | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 68.9±17.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-fluoro-4-isocyanato-2-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 181.5±40.0 °C at 760 mmHg |
| Molecular Formula | C8H3F4NO |
| Molecular Weight | 205.109 |
| Flash Point | 68.9±17.0 °C |
| Exact Mass | 205.015076 |
| PSA | 29.43000 |
| LogP | 4.27 |
| Vapour Pressure | 0.9±0.3 mmHg at 25°C |
| Index of Refraction | 1.450 |
| InChIKey | OPPYFFRLKJUEOS-UHFFFAOYSA-N |
| SMILES | O=C=Nc1ccc(F)c(C(F)(F)F)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S26 |
| RIDADR | UN 2922 8/PG 1 |
| WGK Germany | 3 |
| HS Code | 2929109000 |
| HS Code | 2929109000 |
|---|---|
| Summary | 2929109000. other isocyanates. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Bicyclic [4.1. 0] heptanes as phenyl replacements for melanin concentrating hormone receptor antagonists. Xu, Ruo, et al.
Bioorg. Med. Chem. 14(10) , 3285-99, (2006)
|
|
|
Discovery of orally efficacious melanin-concentrating hormone receptor-1 antagonists as antiobesity agents. Synthesis, SAR, and biological evaluation of bicyclo [3.1. 0] hexyl ureas. McBriar MD, et al.
J. Med. Chem. 49(7) , 2294-2310, (2006)
|
| 4-Fluoro-3-(trifluoromethyl)phenyl isocyanate |
| MFCD00673072 |
| 1-Fluoro-4-isocyanato-2-(trifluoromethyl)benzene |
| Benzene, 1-fluoro-4-isocyanato-2-(trifluoromethyl)- |