7-Hydroxyquetiapine structure
|
Common Name | 7-Hydroxyquetiapine | ||
|---|---|---|---|---|
| CAS Number | 139079-39-3 | Molecular Weight | 399.50700 | |
| Density | 1.33 g/cm3 | Boiling Point | 612.4ºC at 760 mmHg | |
| Molecular Formula | C21H25N3O3S | Melting Point | 56-60ºC | |
| MSDS | N/A | Flash Point | 324.2ºC | |
| Symbol |
GHS02, GHS06, GHS08 |
Signal Word | Danger | |
Use of 7-Hydroxyquetiapine7-Hydroxyquetiapine (ICI 214227) is the major active metabolite of antipsychotic medicine Quetiapine[1]. |
| Name | 6-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]benzo[b][1,4]benzothiazepin-2-ol |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Hydroxyquetiapine (ICI 214227) is the major active metabolite of antipsychotic medicine Quetiapine[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.33 g/cm3 |
|---|---|
| Boiling Point | 612.4ºC at 760 mmHg |
| Melting Point | 56-60ºC |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.50700 |
| Flash Point | 324.2ºC |
| Exact Mass | 399.16200 |
| PSA | 93.83000 |
| LogP | 1.87300 |
| Vapour Pressure | 7.5E-16mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | VEGVCHRFYPFJFO-UHFFFAOYSA-N |
| SMILES | OCCOCCN1CCN(C2=Nc3ccc(O)cc3Sc3ccccc32)CC1 |
| Storage condition | -20°C Freezer |
| Symbol |
GHS02, GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H301 + H311 + H331-H370 |
| Precautionary Statements | P210-P260-P280-P301 + P310-P311 |
| Hazard Codes | F,T |
| Risk Phrases | 11-23/24/25-39/23/24/25 |
| Safety Phrases | 16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
|
Determination of an antipsychotic agent (ICI 204,636) and its 7-hydroxy metabolite in human plasma by high-performance liquid chromatography and gas chromatography-mass spectrometry.
J. Chromatogr. A. 573(1) , 49-57, (1992) ICI 204,636 (I) is an orally active antipsychotic agent under development for the treatment of schizophrenia in humans. It is partially converted in animals to an active 7-hydroxy metabolite (II). Met... |
| 7-Hydroxy Quetiapine |
| 7-Hydroxyquetiapine |
| 11-[4-[2-(2-Hydroxyethoxy)Ethyl]-1-Piperazinyl]-Dibenzo[b,f][1,4]Thiazepin-7-Ol |
| Quetiapine Impurity 35 |