1-(2-chloroethyl)-3-naphthalen-2-yl-urea structure
|
Common Name | 1-(2-chloroethyl)-3-naphthalen-2-yl-urea | ||
|---|---|---|---|---|
| CAS Number | 13908-57-1 | Molecular Weight | 248.70800 | |
| Density | 1.286g/cm3 | Boiling Point | 399.1ºC at 760 mmHg | |
| Molecular Formula | C13H13ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.2ºC | |
| Name | 1-(2-chloroethyl)-3-(naphthalen-2-yl)urea |
|---|
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 399.1ºC at 760 mmHg |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.70800 |
| Flash Point | 195.2ºC |
| Exact Mass | 248.07200 |
| PSA | 41.13000 |
| LogP | 3.66400 |
| Vapour Pressure | 1.4E-06mmHg at 25°C |
| Index of Refraction | 1.66 |
| InChIKey | BMPINTUZIXWLFQ-UHFFFAOYSA-N |
| SMILES | O=C(NCCCl)Nc1ccc2ccccc2c1 |
|
~38%
1-(2-chloroethy... CAS#:13908-57-1 |
| Literature: Mounetou; Legault; Lacroix; C-Gaudreault Journal of Medicinal Chemistry, 2001 , vol. 44, # 5 p. 694 - 702 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |