1-(2-chloroethyl)-3-[4-[4-(2-chloroethylcarbamoylamino)phenyl]disulfanylphenyl]urea structure
|
Common Name | 1-(2-chloroethyl)-3-[4-[4-(2-chloroethylcarbamoylamino)phenyl]disulfanylphenyl]urea | ||
|---|---|---|---|---|
| CAS Number | 13908-73-1 | Molecular Weight | 459.41300 | |
| Density | 1.42g/cm3 | Boiling Point | 581.4ºC at 760 mmHg | |
| Molecular Formula | C18H20Cl2N4O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.4ºC | |
| Name | 1-(2-chloroethyl)-3-[4-[[4-(2-chloroethylcarbamoylamino)phenyl]disulfanyl]phenyl]urea |
|---|
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 581.4ºC at 760 mmHg |
| Molecular Formula | C18H20Cl2N4O2S2 |
| Molecular Weight | 459.41300 |
| Flash Point | 305.4ºC |
| Exact Mass | 458.04000 |
| PSA | 132.86000 |
| LogP | 6.13440 |
| Vapour Pressure | 1.65E-13mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | RVBSRFWGYCMGCR-UHFFFAOYSA-N |
| SMILES | O=C(NCCCl)Nc1ccc(SSc2ccc(NC(=O)NCCCl)cc2)cc1 |
|
~%
1-(2-chloroethy... CAS#:13908-73-1 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |