Urea,N-(2-chloroethyl)-N'-(4-fluorophenyl)-N-nitroso- structure
|
Common Name | Urea,N-(2-chloroethyl)-N'-(4-fluorophenyl)-N-nitroso- | ||
|---|---|---|---|---|
| CAS Number | 13909-17-6 | Molecular Weight | 245.63800 | |
| Density | 1.39g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H9ClFN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-chloroethyl)-3-(4-fluorophenyl)-1-nitrosourea |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Molecular Formula | C9H9ClFN3O2 |
| Molecular Weight | 245.63800 |
| Exact Mass | 245.03700 |
| PSA | 61.77000 |
| LogP | 2.65280 |
| Index of Refraction | 1.569 |
| InChIKey | KIHGWAQZRGYIEH-UHFFFAOYSA-N |
| SMILES | O=NN(CCCl)C(=O)Nc1ccc(F)cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |