N-[(E)-Phenylmethylene]benzenesulfonamide structure
|
Common Name | N-[(E)-Phenylmethylene]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 13909-34-7 | Molecular Weight | 245.297 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 406.3±28.0 °C at 760 mmHg | |
| Molecular Formula | C13H11NO2S | Melting Point | 78-81ºC(lit.) | |
| MSDS | USA | Flash Point | 199.5±24.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-Benzylidenebenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 406.3±28.0 °C at 760 mmHg |
| Melting Point | 78-81ºC(lit.) |
| Molecular Formula | C13H11NO2S |
| Molecular Weight | 245.297 |
| Flash Point | 199.5±24.0 °C |
| Exact Mass | 245.051056 |
| PSA | 54.88000 |
| LogP | 3.07 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | MPNRJEPBAYEQBY-SDNWHVSQSA-N |
| SMILES | O=S(=O)(N=Cc1ccccc1)c1ccccc1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| N-[(E)-Phenylmethylene]benzenesulfonamide |
| n-benzylidenebenzenesulfonamide |
| Benzenesulfonamide, N-[(1E)-phenylmethylene]- |
| N-[(E)-Phenylmethylidene]benzenesulfonamide |
| MFCD00011587 |