6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-amine,hydrochloride structure
|
Common Name | 6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-amine,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 13917-16-3 | Molecular Weight | 243.73000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-amine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H18ClNO2 |
|---|---|
| Molecular Weight | 243.73000 |
| Exact Mass | 243.10300 |
| PSA | 44.48000 |
| LogP | 3.02210 |
| InChIKey | WMDJQUTVERCDFT-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)CC(N)CC2.Cl |
| HS Code | 2922299090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-amino-6,7-dihydroxy-1,2,3,4-tetrahydronaphthalene dimethyl ether hydrochloride |
| 1,2,3,4-tetrahydro-6,7-dimethoxy-2-naphthylamine hydrochloride |
| (R,S)-2-amino-6,7-dimethoxytetraline hydrochloride |
| 6,7-DIMETHOXY-1,2,3,4-TETRAHYDRO-NAPHTHALEN-2-YLAMINE HYDROCHLORIDE |
| 2-Amino-6,7-dimethoxy-tetralin-hydrochlorid |
| 6,7-dimethoxy-1,2,3,4-tetrahydro-2-naphthylamine hydrochloride |
| 2-amino-1,2,3,4-tetrahydro-6,7-dimethoxynaphthalene hydrochloride |
| 2-amino-6,7-dimethoxytetraline hydrochloride |
| 6,7-Dimethoxy-1,2,3,4-tetrahydronaphthalen-2-amine hydrochloride |
| 2-Naphthalenamine,1,2,3,4-tetrahydro-6,7-dimethoxy-,hydrochloride |