Kitasamycin structure
|
Common Name | Kitasamycin | ||
|---|---|---|---|---|
| CAS Number | 1392-21-8 | Molecular Weight | 785.958 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 874.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C40H67NO14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 482.8±34.3 °C | |
Use of KitasamycinLeucomycin (kitasamycin) is a macrolide antibiotic produced by Streptomyces kitasatoensis[1][2][3][4]. |
| Name | Kitasamycin |
|---|---|
| Synonym | More Synonyms |
| Description | Leucomycin (kitasamycin) is a macrolide antibiotic produced by Streptomyces kitasatoensis[1][2][3][4]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 874.7±65.0 °C at 760 mmHg |
| Molecular Formula | C40H67NO14 |
| Molecular Weight | 785.958 |
| Flash Point | 482.8±34.3 °C |
| Exact Mass | 785.456177 |
| LogP | 3.35 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | XYJOGTQLTFNMQG-UHFFFAOYSA-N |
| SMILES | COC1C(O)CC(=O)OC(C)CC=CC=CC(O)C(C)CC(CC=O)C1OC1OC(C)C(OC2CC(C)(O)C(O)C(C)O2)C(N(C)C)C1O |
| Storage condition | 2-8°C |
| Water Solubility | ethanol: 50 mg/mL, clear to slightly hazy, light-yellow |
| (2S,3S,4R,6S)-6-{[(2R,3S,4R,5R,6S)-6-{[(4R,5S,6S,7R,9R,10R,11E,13E,16R)-4,10-Dihydroxy-5-methoxy-9,16-dimethyl-2-oxo-7-(2-oxoethyl)oxacyclohexadeca-11,13-dien-6-yl]oxy}-4-(dimethylamino)-5-hydroxy-2-methyltetrahydro-2H-pyran-3-yl]oxy}-4-hydroxy-2,4-dimethyltetrahydro-2H-pyran-3-yl 3-methylbutanoate (non-preferred name) |
| Ayermycin |
| 3-Deacetyljosamycin |
| Sineptina |
| Syneptine |
| (2S,3S,4R,6S)-6-{[(2R,3S,4R,5R,6S)-6-{[(4R,5S,6S,7R,9R,10R,11E,13E,16R)-4,10-Dihydroxy-5-methoxy-9,16-dimethyl-2-oxo-7-(2-oxoethyl)oxacyclohexadeca-11,13-dien-6-yl]oxy}-4-(dimethylamino)-5-hydroxy-2-methyltetrahydro-2H-pyran-3-yl]oxy}-4-hydroxy-2,4-dimethyltetrahydro-2H-pyran-3-yl 3-methylbutanoate |
| EINECS 232-429-6 |
| 3-O-Deacetyljosamycin |
| Kitasamycin |
| Leucomycin A1 |
| Stereomycine |