(1,2-diphenyl-2-triethylsilyloxyethoxy)-triethylsilane structure
|
Common Name | (1,2-diphenyl-2-triethylsilyloxyethoxy)-triethylsilane | ||
|---|---|---|---|---|
| CAS Number | 13960-17-3 | Molecular Weight | 442.78100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H42O2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1,2-diphenyl-2-triethylsilyloxyethoxy)-triethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H42O2Si2 |
|---|---|
| Molecular Weight | 442.78100 |
| Exact Mass | 442.27200 |
| PSA | 18.46000 |
| LogP | 8.51260 |
| InChIKey | WLBBHTZBGSDKGA-UHFFFAOYSA-N |
| SMILES | CC[Si](CC)(CC)OC(c1ccccc1)C(O[Si](CC)(CC)CC)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1,2-diphenyl-1,2-bis(triethylsiloxy)ethane |
| 1.2-Diphenyl-1.2-bis-(triethylsiloxy)-ethan |
| 4,7-Dioxa-3,8-disiladecane,3,3,8,8-tetraethyl-5,6-diphenyl |