Benzil structure
|
Common Name | Benzil | ||
|---|---|---|---|---|
| CAS Number | 134-81-6 | Molecular Weight | 210.228 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 347.0±11.0 °C at 760 mmHg | |
| Molecular Formula | C14H10O2 | Melting Point | 94-95 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 142.6±4.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | benzil |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 347.0±11.0 °C at 760 mmHg |
| Melting Point | 94-95 °C(lit.) |
| Molecular Formula | C14H10O2 |
| Molecular Weight | 210.228 |
| Flash Point | 142.6±4.9 °C |
| Exact Mass | 210.068085 |
| PSA | 34.14000 |
| LogP | 3.38 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | WURBFLDFSFBTLW-UHFFFAOYSA-N |
| SMILES | O=C(C(=O)c1ccccc1)c1ccccc1 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Water Solubility | 0.5 g/L (20 ºC) |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| RTECS | DD1925000 |
| HS Code | 29143900 |
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 29143900 |
|---|
|
Bio-relevant complexes of novel N2O2 type heterocyclic ligand: Synthesis, structural elucidation, biological evaluation and docking studies.
J. Photochem. Photobiol. B, Biol. 149 , 93-102, (2015) Organic and inorganic entities [Cu(II), Co(II), Ni(II) and Zn(II)] have been bridged by N2O2 type heterocyclic imine (CN) ligand for the synthesis of novel organic-inorganic bridged complexes of the t... |
|
|
Identification and characterization of novel benzil (diphenylethane-1,2-dione) analogues as inhibitors of mammalian carboxylesterases.
J. Med. Chem. 48 , 2906-15, (2005) Carboxylesterases (CE) are ubiquitous enzymes responsible for the metabolism of xenobiotics. Because the structural and amino acid homology among esterases of different classes, the identification of ... |
|
|
Fluorescence derivatization method for sensitive chromatographic determination of zidovudine based on the Huisgen reaction.
J. Chromatogr. A. 1355 , 206-10, (2014) A novel pre-column fluorescence derivatization method for chromatographic analysis of azide compounds was developed based on the Huisgen reaction, which is a specific cycloaddition reaction between an... |
| 1,2-Ethanedione, 1,2-diphenyl- |
| Dibenzoyl |
| Dibenzoyl Zone Refined |
| EINECS 205-157-0 |
| Diphenylethanedione Zone Refined |
| MFCD00003080 |
| Diphenylethanedione |
| Bibenzoyl |
| Diphenyl-a,b-diketone |
| Benzil |
| 1,2-diphenylethane-1,2-dione |
| Esacure KBO |
| CHC-12 |
| Diphenylglyoxal Zone Refined |