yunnanxane structure
|
Common Name | yunnanxane | ||
|---|---|---|---|---|
| CAS Number | 139713-81-8 | Molecular Weight | 562.69 | |
| Density | 1.16g/cm3 | Boiling Point | 611.9ºC at 760mmHg | |
| Molecular Formula | C31H46O9 | Melting Point | 161℃ | |
| MSDS | N/A | Flash Point | 185ºC | |
Use of yunnanxaneYunnanxane (compound 1) is a taxane diterpenoid that can be found in Taxus chinensis var.[1]. |
| Name | (1β,2β,3β,8α,10α,14β)-2,5,10-Triacetoxytaxa-4(20),11-dien-14-yl ( 2R,3S)-3-hydroxy-2-methylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Yunnanxane (compound 1) is a taxane diterpenoid that can be found in Taxus chinensis var.[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 611.9ºC at 760mmHg |
| Melting Point | 161℃ |
| Molecular Formula | C31H46O9 |
| Molecular Weight | 562.69 |
| Flash Point | 185ºC |
| Exact Mass | 562.31400 |
| PSA | 125.43000 |
| LogP | 4.44900 |
| Vapour Pressure | 1.57E-17mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | FMPIEMVVEJGMCY-YYURHUSPSA-N |
| SMILES | C=C1C(OC(C)=O)CCC2(C)CC(OC(C)=O)C3=C(C)CC(OC(=O)C(C)C(C)O)C(C(OC(C)=O)C12)C3(C)C |
| Hazard Codes | Xi |
|---|
| Maslinic acid,Crataegolic acid |
| Crataegolic acid |
| CRATEGOLIC ACID |
| maslinicacid |