1-(1-hydroxycyclohexyl)-3-phenylpropan-1-one structure
|
Common Name | 1-(1-hydroxycyclohexyl)-3-phenylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 139719-68-9 | Molecular Weight | 232.31800 | |
| Density | 1.104g/cm3 | Boiling Point | 369.3ºC at 760 mmHg | |
| Molecular Formula | C15H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.6ºC | |
| Name | 1-(1-hydroxycyclohexyl)-3-phenylpropan-1-one |
|---|
| Density | 1.104g/cm3 |
|---|---|
| Boiling Point | 369.3ºC at 760 mmHg |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.31800 |
| Flash Point | 157.6ºC |
| Exact Mass | 232.14600 |
| PSA | 37.30000 |
| LogP | 2.88350 |
| Vapour Pressure | 4.16E-06mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | JNPMKVGVKUKYRV-UHFFFAOYSA-N |
| SMILES | O=C(CCc1ccccc1)C1(O)CCCCC1 |
| HS Code | 2914400090 |
|---|
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |