Urea,1,1'-(4,4'-biphenylylene)bis[3-(2-chloroethyl)- (8CI) structure
|
Common Name | Urea,1,1'-(4,4'-biphenylylene)bis[3-(2-chloroethyl)- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 13991-69-0 | Molecular Weight | 395.28300 | |
| Density | 1.343g/cm3 | Boiling Point | 538.7ºC at 760mmHg | |
| Molecular Formula | C18H20Cl2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.6ºC | |
| Name | 1-(2-chloroethyl)-3-[4-[4-(2-chloroethylcarbamoylamino)phenyl]phenyl]urea |
|---|
| Density | 1.343g/cm3 |
|---|---|
| Boiling Point | 538.7ºC at 760mmHg |
| Molecular Formula | C18H20Cl2N4O2 |
| Molecular Weight | 395.28300 |
| Flash Point | 279.6ºC |
| Exact Mass | 394.09600 |
| PSA | 82.26000 |
| LogP | 5.00200 |
| Vapour Pressure | 1.13E-11mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | ASVIYSWARNVBBF-UHFFFAOYSA-N |
| SMILES | O=C(NCCCl)Nc1ccc(-c2ccc(NC(=O)NCCCl)cc2)cc1 |
|
~%
Urea,1,1'-(4,4'... CAS#:13991-69-0 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |