Folipastatin structure
|
Common Name | Folipastatin | ||
|---|---|---|---|---|
| CAS Number | 139959-71-0 | Molecular Weight | 380.43400 | |
| Density | 1.213g/cm3 | Boiling Point | 588.3ºC at 760mmHg | |
| Molecular Formula | C23H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.3ºC | |
Use of FolipastatinFolipastatin is a potent inhibitor of phospholipase A2 with an IC50 of 39 μM. Folipastatin is a new depsidone compound from Aspergillus unguis[1]. |
| Name | 1,7-bis[(Z)-but-2-en-2-yl]-3,9-dihydroxy-4,10-dimethylbenzo[b][1,4]benzodioxepin-6-one |
|---|---|
| Synonym | More Synonyms |
| Description | Folipastatin is a potent inhibitor of phospholipase A2 with an IC50 of 39 μM. Folipastatin is a new depsidone compound from Aspergillus unguis[1]. |
|---|---|
| Related Catalog | |
| Target |
phospholipase A2[1] |
| References |
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 588.3ºC at 760mmHg |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.43400 |
| Flash Point | 204.3ºC |
| Exact Mass | 380.16200 |
| PSA | 75.99000 |
| LogP | 5.88590 |
| Vapour Pressure | 1.94E-14mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | JJMKBGPTPXPMBH-UHFFFAOYSA-N |
| SMILES | CC=C(C)c1cc(O)c(C)c2c1Oc1c(C)c(O)cc(C(C)=CC)c1C(=O)O2 |
| 11H-Dibenzo(b,e)(1,4)dioxepin-11-one,3,8-dihydroxy-4,9-dimethyl-1,6-bis(1-methyl-1-propenyl)-,(Z,Z) |
| folipastatin |
| 11H-Dibenzo(b,e)(1,4)dioxepin-11-one,1,6-bis(1-methyl-1-propenyl)-3,8-dihydroxy-4,9-dimethyl-,(Z,Z) |