ethyl 2-chloro-2-nitroacetate structure
|
Common Name | ethyl 2-chloro-2-nitroacetate | ||
|---|---|---|---|---|
| CAS Number | 14011-27-9 | Molecular Weight | 167.54800 | |
| Density | 1.366g/cm3 | Boiling Point | 194.8ºC at 760 mmHg | |
| Molecular Formula | C4H6ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 71.6ºC | |
| Name | ethyl 2-chloro-2-nitroacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.366g/cm3 |
|---|---|
| Boiling Point | 194.8ºC at 760 mmHg |
| Molecular Formula | C4H6ClNO4 |
| Molecular Weight | 167.54800 |
| Flash Point | 71.6ºC |
| Exact Mass | 166.99900 |
| PSA | 72.12000 |
| LogP | 0.91430 |
| Vapour Pressure | 0.433mmHg at 25°C |
| Index of Refraction | 1.453 |
| InChIKey | FITIJMZLRSVIRB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cl)[N+](=O)[O-] |
| HS Code | 2915900090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 9 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Chlor-nitro-essigsaeure-aethylester |
| ethyl chloronitroacetate |
| chloro-nitro-acetic acid ethyl ester |
| ethyl ester of chloronitroacetic acid |
| Chlor-nitro-essigsaeure-ethylester |
| Acetic acid,chloronitro-,ethyl ester |