N-(2-chloroprop-2-enyl)-4-methylbenzenesulfonamide structure
|
Common Name | N-(2-chloroprop-2-enyl)-4-methylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 140160-65-2 | Molecular Weight | 245.72600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-chloroprop-2-enyl)-4-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12ClNO2S |
|---|---|
| Molecular Weight | 245.72600 |
| Exact Mass | 245.02800 |
| PSA | 54.55000 |
| LogP | 3.49750 |
| InChIKey | VLIXJEHAMACCPC-UHFFFAOYSA-N |
| SMILES | C=C(Cl)CNS(=O)(=O)c1ccc(C)cc1 |
|
~34%
N-(2-chloroprop... CAS#:140160-65-2 |
| Literature: Fraser, Fiona A.; Proctor, George R.; Redpath, James Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1992 , # 4 p. 445 - 448 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzenesulfonamide,N-(2-chloro-2-propenyl)-4-methyl |
| 2-chloro-N-tosylprop-2-enylamine |