Eupalinolide H structure
|
Common Name | Eupalinolide H | ||
|---|---|---|---|---|
| CAS Number | 1402067-83-7 | Molecular Weight | 420.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H28O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Eupalinolide HEupalinolide H, a sesquiterpene lactone, has the potential to be used as natural anti-inflammatory agent[1]. |
| Name | Eupalinolide H |
|---|
| Description | Eupalinolide H, a sesquiterpene lactone, has the potential to be used as natural anti-inflammatory agent[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Eupalinolide H (2.5, 10, 40 μM) has significant inhibitory effects on IL-6 and TNF-α production in in RAW 264.7 cells[1]. |
| References |
| Molecular Formula | C22H28O8 |
|---|---|
| Molecular Weight | 420.45 |
| InChIKey | INXZZSZBRLXKNT-UHFFFAOYSA-N |
| SMILES | C=C1C(=O)OC2C=C(C)C(OC(C)=O)CC=C(CO)CC(OC(=O)C(C)=CCO)C12 |