Z-Pro-Ala-OH structure
|
Common Name | Z-Pro-Ala-OH | ||
|---|---|---|---|---|
| CAS Number | 14030-00-3 | Molecular Weight | 320.34000 | |
| Density | 1.301 g/cm3 | Boiling Point | 582.3ºC at 760 mmHg | |
| Molecular Formula | C16H20N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306ºC | |
Use of Z-Pro-Ala-OHZ-Pro-Ala is an acid carboxypeptidase. Z-Pro-Ala can be isolated from grains and leaves of wheat, Triticum aestivum L[1]. |
| Name | (2S)-2-[[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]amino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Z-Pro-Ala is an acid carboxypeptidase. Z-Pro-Ala can be isolated from grains and leaves of wheat, Triticum aestivum L[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.301 g/cm3 |
|---|---|
| Boiling Point | 582.3ºC at 760 mmHg |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.34000 |
| Flash Point | 306ºC |
| Exact Mass | 320.13700 |
| PSA | 95.94000 |
| LogP | 1.70570 |
| Vapour Pressure | 2.11E-14mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | XMVYSQUPGXSTJR-AAEUAGOBSA-N |
| SMILES | CC(NC(=O)C1CCCN1C(=O)OCc1ccccc1)C(=O)O |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| EINECS 237-868-7 |
| N-Cbz-L-Pro-L-Ala |
| Z-Pro-Ala-OH |
| Cbz-L-Pro-L-Ala-OH |