6'-O-Cinnamoyl-8-epikingisidic acid structure
|
Common Name | 6'-O-Cinnamoyl-8-epikingisidic acid | ||
|---|---|---|---|---|
| CAS Number | 1403984-03-1 | Molecular Weight | 520.483 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 804.9±65.0 °C at 760 mmHg | |
| Molecular Formula | C25H28O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.5±27.8 °C | |
Use of 6'-O-Cinnamoyl-8-epikingisidic acid6'-O-Cinnamoyl-8-epikingisidic acid (6'-O-trans-cinnamoyl 8-epikingisidic acid) is a secoiridoid constituent isolated from the dried fruits of Ligustrum lucidum AIT[1]. |
| Name | (1R,4aS,8S,8aS)-8-(((2S,3R,4S,5S,6R)-6-((cinnamoyloxy)methyl)-3,4,5-trihydroxytetrahydro-2H-pyran-2-yl)oxy)-1-methyl-3-oxo-4,4a,8,8a-tetrahydro-1H,3H-pyrano[3,4-c]pyran-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 6'-O-Cinnamoyl-8-epikingisidic acid (6'-O-trans-cinnamoyl 8-epikingisidic acid) is a secoiridoid constituent isolated from the dried fruits of Ligustrum lucidum AIT[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 804.9±65.0 °C at 760 mmHg |
| Molecular Formula | C25H28O12 |
| Molecular Weight | 520.483 |
| Flash Point | 272.5±27.8 °C |
| Exact Mass | 520.158081 |
| PSA | 178.28000 |
| LogP | 2.79 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | XPUDIJARFNUSHK-AACBIXFPSA-N |
| SMILES | CC1OC(=O)CC2C(C(=O)O)=COC(OC3OC(COC(=O)C=Cc4ccccc4)C(O)C(O)C3O)C12 |
| Hazard Codes | Xi |
|---|
| (1R,4aS,8S,8aS)-1-Methyl-3-oxo-8-({6-O-[(2E)-3-phenyl-2-propenoyl]-β-D-glucopyranosyl}oxy)-4,4a,8,8a-tetrahydro-1H,3H-pyrano[3,4-c]pyran-5-carboxylic acid |
| 1H,3H-Pyrano[3,4-c]pyran-5-carboxylic acid, 4,4a,8,8a-tetrahydro-1-methyl-3-oxo-8-[[6-O-[(2E)-1-oxo-3-phenyl-2-propen-1-yl]-β-D-glucopyranosyl]oxy]-, (1R,4aS,8S,8aS)- |