Benzene,1-bromo-2,3,5,6-tetrafluoro-4-(pentafluorophenoxy)- (9CI) structure
|
Common Name | Benzene,1-bromo-2,3,5,6-tetrafluoro-4-(pentafluorophenoxy)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 14055-44-8 | Molecular Weight | 411.01700 | |
| Density | 1.919g/cm3 | Boiling Point | 198.5ºC at 760 mmHg | |
| Molecular Formula | C12BrF9O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 100.4ºC | |
| Name | 1-bromo-2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.919g/cm3 |
|---|---|
| Boiling Point | 198.5ºC at 760 mmHg |
| Molecular Formula | C12BrF9O |
| Molecular Weight | 411.01700 |
| Flash Point | 100.4ºC |
| Exact Mass | 409.89900 |
| PSA | 9.23000 |
| LogP | 5.49330 |
| Vapour Pressure | 0.506mmHg at 25°C |
| Index of Refraction | 1.475 |
| InChIKey | UHIGTBMVQHTRMG-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(Oc2c(F)c(F)c(Br)c(F)c2F)c(F)c1F |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-Brom-perfluordiphenylether |
| PC6629 |
| 1-bromo-2,3,5,6-tetrafluoro-4-pentafluorophenoxybenzene |
| 1-Bromo-4-(pentafluorophenoxy)-2,3,5,6-tetrafluorobenzene |
| 4-Bromo-2,2',3,3',4',5,5',6,6'-nonafluorodiphenyl ether |
| 4-Brom-nonafluordiphenyl-ether |
| (4-Brom-tetrafluorphenyl)-pentafluorphenyl-ether |
| 4-bromo-perfluorodiphenylether |