Ether,pentafluorophenyl 2,3,5,6-tetrafluoro-p-tolyl (8CI) structure
|
Common Name | Ether,pentafluorophenyl 2,3,5,6-tetrafluoro-p-tolyl (8CI) | ||
|---|---|---|---|---|
| CAS Number | 20546-13-8 | Molecular Weight | 346.14800 | |
| Density | 1.616g/cm3 | Boiling Point | 183.8ºC at 760 mmHg | |
| Molecular Formula | C13H3F9O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 71.3ºC | |
| Name | 1,2,3,4,5-pentafluoro-6-(2,3,5,6-tetrafluoro-4-methylphenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.616g/cm3 |
|---|---|
| Boiling Point | 183.8ºC at 760 mmHg |
| Molecular Formula | C13H3F9O |
| Molecular Weight | 346.14800 |
| Flash Point | 71.3ºC |
| Exact Mass | 346.00400 |
| PSA | 9.23000 |
| LogP | 5.03920 |
| Vapour Pressure | 1.04mmHg at 25°C |
| Index of Refraction | 1.449 |
| InChIKey | UKPQVSMALKZRDO-UHFFFAOYSA-N |
| SMILES | Cc1c(F)c(F)c(Oc2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
|
~%
Ether,pentafluo... CAS#:20546-13-8 |
| Literature: De Pasquale,R.J.; Tamborski,C. Journal of Organometallic Chemistry, 1968 , vol. 13, p. 273 - 282 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Methyl-nonafluordiphenylether |