isopropoxycarbonyl-l-valine structure
|
Common Name | isopropoxycarbonyl-l-valine | ||
|---|---|---|---|---|
| CAS Number | 140923-27-9 | Molecular Weight | 203.23600 | |
| Density | 1.098g/cm3 | Boiling Point | 334.517ºC at 760 mmHg | |
| Molecular Formula | C9H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.111ºC | |
| Name | isopropoxycarbonyl-l-valine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.098g/cm3 |
|---|---|
| Boiling Point | 334.517ºC at 760 mmHg |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.23600 |
| Flash Point | 156.111ºC |
| Exact Mass | 203.11600 |
| PSA | 75.63000 |
| LogP | 1.62110 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.458 |
| InChIKey | BOEQBJGCRDSQAI-ZETCQYMHSA-N |
| SMILES | CC(C)OC(=O)NC(C(=O)O)C(C)C |
| HS Code | 2924199090 |
|---|
|
~%
isopropoxycarbo... CAS#:140923-27-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 42, # 11 p. 2041 - 2045 |
|
~97%
isopropoxycarbo... CAS#:140923-27-9 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 13, # 20 p. 3531 - 3536 |
|
~%
isopropoxycarbo... CAS#:140923-27-9 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 13, # 20 p. 3531 - 3536 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ipoc-Val-OH |
| N-isopropoxycarbonyl-S-valine |
| i-propoxycarbonyl-L-valine |
| i-propyloxycarbonyl-L-valine |