Val-OBzl HCl structure
|
Common Name | Val-OBzl HCl | ||
|---|---|---|---|---|
| CAS Number | 2462-34-2 | Molecular Weight | 243.730 | |
| Density | N/A | Boiling Point | 285.5ºC at 760 mmHg | |
| Molecular Formula | C12H18ClNO2 | Melting Point | 138 °C | |
| MSDS | Chinese USA | Flash Point | 143.7ºC | |
Use of Val-OBzl HClH-Val-Obzl.HCl is a valine derivative[1]. |
| Name | benzyl (2S)-2-amino-3-methylbutanoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | H-Val-Obzl.HCl is a valine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Boiling Point | 285.5ºC at 760 mmHg |
|---|---|
| Melting Point | 138 °C |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.730 |
| Flash Point | 143.7ºC |
| Exact Mass | 243.102600 |
| PSA | 52.32000 |
| LogP | 3.21540 |
| Vapour Pressure | 0.0028mmHg at 25°C |
| Index of Refraction | -10 ° (C=2, H2O) |
| InChIKey | ZIUNABFUHGBCMF-MERQFXBCSA-N |
| SMILES | CC(C)C(N)C(=O)OCc1ccccc1.Cl |
| Storage condition | −20°C |
| Precursor 6 | |
|---|---|
| DownStream 5 | |
|
Synthesis of 7-substituted benzolactam-V8s and their selectivity for protein kinase C isozymes.
Org. Lett. 4 , 2377-2380, (2002) [reaction: see text] Condensation of L-valine benzyl ester toluenesulfonic acid salt with a substituted cyclohexadione followed by aromatization with the assistance of NBS provides an N-aryl L-valine ... |
| H-Val-OBn HCl |
| Benzyl L-valinate hydrochloride (1:1) |
| Val-OBzl HCl |
| 2-Butanaminium, 3-methyl-1-oxo-1-(phenylmethoxy)-, chloride, (2S)- (1:1) |
| MFCD00058010 |
| H-Val-OBzl.HCl |
| H-L-Val-OBn*HCl |
| valine benzyl ester hydrochloride |
| L-Valine Benzyl Ester Hydrochloride |
| (2S)-1-(Benzyloxy)-3-methyl-1-oxo-2-butanaminium chloride |
| H-Val-OBzl·HCl |
| L-valine, phenylmethyl ester, hydrochloride (1:1) |
| L-Valine benzylester hydrochloride |