Frangulin B structure
|
Common Name | Frangulin B | ||
|---|---|---|---|---|
| CAS Number | 14101-04-3 | Molecular Weight | 402.35200 | |
| Density | 1.645g/cm3 | Boiling Point | 781.4ºC at 760mmHg | |
| Molecular Formula | C20H18O9 | Melting Point | 196℃ | |
| MSDS | Chinese USA | Flash Point | 282.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | frangulin b |
|---|---|
| Synonym | More Synonyms |
| Density | 1.645g/cm3 |
|---|---|
| Boiling Point | 781.4ºC at 760mmHg |
| Melting Point | 196℃ |
| Molecular Formula | C20H18O9 |
| Molecular Weight | 402.35200 |
| Flash Point | 282.4ºC |
| Exact Mass | 402.09500 |
| PSA | 153.75000 |
| LogP | 0.00100 |
| Vapour Pressure | 3E-25mmHg at 25°C |
| Index of Refraction | 1.726 |
| InChIKey | AEQMIFRODRFTJF-SLFFLAALSA-N |
| SMILES | Cc1cc(O)c2c(c1)C(=O)c1cc(OC3OCC(O)(CO)C3O)cc(O)c1C2=O |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
|
Frangulin B, an antagonist of collagen-induced platelet aggregation and adhesion, isolated from Rhamnus formosana.
Thromb. Haemost. 70(6) , 1014-8, (1993) Emodin and its glycoside frangulin B were isolated from the plant Rhamnus formosana. Emodin inhibited the aggregation of rabbit platelets induced by arachidonic acid and collagen, without affecting th... |
|
|
In vitro anti-inflammatory effects of quercetin 3-O-methyl ether and other constituents from Rhamnus species.
Planta Med. 67(8) , 745-7, (2001) The anti-inflammatory activities of the isolated flavonoids, quercetin 3-O-methyl ether (1), kaempferol (2), and quercetin (3), of Rhamnus nakaharai, and anthraquinone, frangulin B (4), of Rhamnus for... |
| EModin 6-apioside |
| EMODIN-L-RHAMNOSIDE |
| RAHMNOXANTHIN |
| Einecs 237-953-9 |
| EMODIN-6-O-APIOSIDE |